C31H31N3O8 — CID 163090662
N-[2-[1-(6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene)ethylamino]ethyl]-5-oxo-1-phenylpyrrolidine-3-carboxamide (PubChem CID 163090662) has the molecular formula C31H31N3O8 and a molecular weight of 573.60 g/mol. Its IUPAC name is N-[2-[1-(6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene)ethylamino]ethyl]-5-oxo-1-phenylpyrrolidine-3-carboxamide.
| Compound Name | N-[2-[1-(6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene)ethylamino]ethyl]-5-oxo-1-phenylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 163090662 |
| Molecular Formula | C31H31N3O8 |
| Molecular Weight | 573.60 g/mol |
| Exact Mass | 573.21 |
| IUPAC Name | N-[2-[1-(6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene)ethylamino]ethyl]-5-oxo-1-phenylpyrrolidine-3-carboxamide |
| SMILES | CC(=O)c1c(O)c(C)c(O)c2c1OC1=CC(=O)C(=C(C)NCCNC(=O)C3CC(=O)N(c4ccccc4)C3)C(=O)C12C |
| InChI | InChI=1S/C31H31N3O8/c1-15-26(38)24(17(3)35)28-25(27(15)39)31(4)21(42-28)13-20(36)23(29(31)40)16(2)32-10-11-33-30(41)18-12-22(37)34(14-18)19-8-6-5-7-9-19/h5-9,13,18,32,38-39H,10-12,14H2,1-4H3,(H,33,41) |
| InChIKey | ZJHKCDMAIUPCDN-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 162.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.60 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|