C18H28O8 — CID 163063133
9,17,18,19-tetrahydroxy-14-methyl-3,15,20-trioxatricyclo[14.3.1.06,10]icos-12-en-4-one (PubChem CID 163063133) has the molecular formula C18H28O8 and a molecular weight of 372.41 g/mol. Its IUPAC name is 9,17,18,19-tetrahydroxy-14-methyl-3,15,20-trioxatricyclo[14.3.1.06,10]icos-12-en-4-one.
| Compound Name | 9,17,18,19-tetrahydroxy-14-methyl-3,15,20-trioxatricyclo[14.3.1.06,10]icos-12-en-4-one |
|---|---|
| PubChem CID | 163063133 |
| Molecular Formula | C18H28O8 |
| Molecular Weight | 372.41 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 9,17,18,19-tetrahydroxy-14-methyl-3,15,20-trioxatricyclo[14.3.1.06,10]icos-12-en-4-one |
| SMILES | CC1C=CCC2C(O)CCC2CC(=O)OCC2OC(O1)C(O)C(O)C2O |
| InChI | InChI=1S/C18H28O8/c1-9-3-2-4-11-10(5-6-12(11)19)7-14(20)24-8-13-15(21)16(22)17(23)18(25-9)26-13/h2-3,9-13,15-19,21-23H,4-8H2,1H3 |
| InChIKey | UITFAPYZAFENSO-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.41 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|