C19H24O13 — CID 73078390
9,18,19,20-tetrahydroxy-9-methyl-12,14-dioxo-2,4,11,15,21-pentaoxatetracyclo[15.3.1.17,10.03,8]docos-5-ene-6-carboxylic acid (PubChem CID 73078390) has the molecular formula C19H24O13 and a molecular weight of 460.39 g/mol. Its IUPAC name is 9,18,19,20-tetrahydroxy-9-methyl-12,14-dioxo-2,4,11,15,21-pentaoxatetracyclo[15.3.1.17,10.03,8]docos-5-ene-6-carboxylic acid.
| Compound Name | 9,18,19,20-tetrahydroxy-9-methyl-12,14-dioxo-2,4,11,15,21-pentaoxatetracyclo[15.3.1.17,10.03,8]docos-5-ene-6-carboxylic acid |
|---|---|
| PubChem CID | 73078390 |
| Molecular Formula | C19H24O13 |
| Molecular Weight | 460.39 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | 9,18,19,20-tetrahydroxy-9-methyl-12,14-dioxo-2,4,11,15,21-pentaoxatetracyclo[15.3.1.17,10.03,8]docos-5-ene-6-carboxylic acid |
| SMILES | CC1(O)C2CC3C(C(=O)O)=COC(OC4OC(COC(=O)CC(=O)O2)C(O)C(O)C4O)C31 |
| InChI | InChI=1S/C19H24O13/c1-19(27)9-2-6-7(16(25)26)4-29-17(12(6)19)32-18-15(24)14(23)13(22)8(30-18)5-28-10(20)3-11(21)31-9/h4,6,8-9,12-15,17-18,22-24,27H,2-3,5H2,1H3,(H,25,26) |
| InChIKey | ZILVNWQDAWWXCU-UHFFFAOYSA-N |
| XLogP | -2.62 |
| TPSA | 198.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.39 |
| LogP ≤ 5 | -2.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|