C21H34O12 — CID 162853786
(1R,4R,7S,13S,15R,19R,20R,21S,22S,24R)-7,13,20,21,22,24-hexahydroxy-11,15-dimethyl-3,5,9,18,23-pentaoxatricyclo[17.3.1.14,7]tetracos-11-en-10-one (PubChem CID 162853786) has the molecular formula C21H34O12 and a molecular weight of 478.49 g/mol. Its IUPAC name is (1R,4R,7S,13S,15R,19R,20R,21S,22S,24R)-7,13,20,21,22,24-hexahydroxy-11,15-dimethyl-3,5,9,18,23-pentaoxatricyclo[17.3.1.14,7]tetracos-11-en-10-one.
| Compound Name | (1R,4R,7S,13S,15R,19R,20R,21S,22S,24R)-7,13,20,21,22,24-hexahydroxy-11,15-dimethyl-3,5,9,18,23-pentaoxatricyclo[17.3.1.14,7]tetracos-11-en-10-one |
|---|---|
| PubChem CID | 162853786 |
| Molecular Formula | C21H34O12 |
| Molecular Weight | 478.49 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | (1R,4R,7S,13S,15R,19R,20R,21S,22S,24R)-7,13,20,21,22,24-hexahydroxy-11,15-dimethyl-3,5,9,18,23-pentaoxatricyclo[17.3.1.14,7]tetracos-11-en-10-one |
| SMILES | CC1=C[C@@H](O)C[C@H](C)CCO[C@@H]2O[C@H](CO[C@@H]3OC[C@](O)(COC1=O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O |
| InChI | InChI=1S/C21H34O12/c1-10-3-4-29-19-16(25)15(24)14(23)13(33-19)7-30-20-17(26)21(28,9-32-20)8-31-18(27)11(2)6-12(22)5-10/h6,10,12-17,19-20,22-26,28H,3-5,7-9H2,1-2H3/t10-,12+,13-,14-,15+,16-,17+,19-,20-,21-/m1/s1 |
| InChIKey | WJNOHRXVWPHKEH-OPCZTGHUSA-N |
| XLogP | -2.44 |
| TPSA | 184.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.49 |
| LogP ≤ 5 | -2.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |