C28H20O11 — CID 163064262
(4,9,19-trihydroxy-11,17-dimethyl-3,7,15,21-tetraoxo-6,22-dioxaheptacyclo[12.9.1.11,16.14,8.02,13.012,26.020,25]hexacosa-2(13),8,10,12(26),16(25),17,19-heptaen-24-yl) acetate (PubChem CID 163064262) has the molecular formula C28H20O11 and a molecular weight of 532.46 g/mol. Its IUPAC name is (4,9,19-trihydroxy-11,17-dimethyl-3,7,15,21-tetraoxo-6,22-dioxaheptacyclo[12.9.1.11,16.14,8.02,13.012,26.020,25]hexacosa-2(13),8,10,12(26),16(25),17,19-heptaen-24-yl) acetate.
| Compound Name | (4,9,19-trihydroxy-11,17-dimethyl-3,7,15,21-tetraoxo-6,22-dioxaheptacyclo[12.9.1.11,16.14,8.02,13.012,26.020,25]hexacosa-2(13),8,10,12(26),16(25),17,19-heptaen-24-yl) acetate |
|---|---|
| PubChem CID | 163064262 |
| Molecular Formula | C28H20O11 |
| Molecular Weight | 532.46 g/mol |
| Exact Mass | 532.10 |
| IUPAC Name | (4,9,19-trihydroxy-11,17-dimethyl-3,7,15,21-tetraoxo-6,22-dioxaheptacyclo[12.9.1.11,16.14,8.02,13.012,26.020,25]hexacosa-2(13),8,10,12(26),16(25),17,19-heptaen-24-yl) acetate |
| SMILES | CC(=O)OC1C2C(=O)c3c(C)cc(O)c4c3C1(COC4=O)C1=C2c2c(C)cc(O)c3c2C(O)(COC3=O)C1=O |
| InChI | InChI=1S/C28H20O11/c1-8-4-12(31)16-20-13(8)17-18-22(32)14-9(2)5-11(30)15-19(14)27(6-37-25(15)34,24(18)39-10(3)29)21(17)23(33)28(20,36)7-38-26(16)35/h4-5,18,24,30-31,36H,6-7H2,1-3H3 |
| InChIKey | RNYVZQRDRWHPNZ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 173.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.46 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|