C22H30O8 — CID 163066017
(3,4-diacetyloxy-10-oxo-2-propyl-2,3,4,7,8,9-hexahydrooxecin-9-yl) hexa-2,4-dienoate (PubChem CID 163066017) has the molecular formula C22H30O8 and a molecular weight of 422.47 g/mol. Its IUPAC name is (3,4-diacetyloxy-10-oxo-2-propyl-2,3,4,7,8,9-hexahydrooxecin-9-yl) hexa-2,4-dienoate.
| Compound Name | (3,4-diacetyloxy-10-oxo-2-propyl-2,3,4,7,8,9-hexahydrooxecin-9-yl) hexa-2,4-dienoate |
|---|---|
| PubChem CID | 163066017 |
| Molecular Formula | C22H30O8 |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | (3,4-diacetyloxy-10-oxo-2-propyl-2,3,4,7,8,9-hexahydrooxecin-9-yl) hexa-2,4-dienoate |
| SMILES | CC=CC=CC(=O)OC1CCC=CC(OC(C)=O)C(OC(C)=O)C(CCC)OC1=O |
| InChI | InChI=1S/C22H30O8/c1-5-7-8-14-20(25)29-19-13-10-9-12-18(27-15(3)23)21(28-16(4)24)17(11-6-2)30-22(19)26/h5,7-9,12,14,17-19,21H,6,10-11,13H2,1-4H3 |
| InChIKey | YIEDBQBSGKLDQQ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|