C15H20O6 — CID 163076264
(1S,5R,8S,9R)-9-acetyl-8-hydroxy-5,9-dimethyl-4,11-dioxatricyclo[6.5.0.01,5]tridecane-3,12-dione (PubChem CID 163076264) has the molecular formula C15H20O6 and a molecular weight of 296.32 g/mol. Its IUPAC name is (1S,5R,8S,9R)-9-acetyl-8-hydroxy-5,9-dimethyl-4,11-dioxatricyclo[6.5.0.01,5]tridecane-3,12-dione.
| Compound Name | (1S,5R,8S,9R)-9-acetyl-8-hydroxy-5,9-dimethyl-4,11-dioxatricyclo[6.5.0.01,5]tridecane-3,12-dione |
|---|---|
| PubChem CID | 163076264 |
| Molecular Formula | C15H20O6 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | (1S,5R,8S,9R)-9-acetyl-8-hydroxy-5,9-dimethyl-4,11-dioxatricyclo[6.5.0.01,5]tridecane-3,12-dione |
| SMILES | CC(=O)[C@]1(C)COC(=O)C[C@@]23CC(=O)O[C@]2(C)CC[C@]31O |
| InChI | InChI=1S/C15H20O6/c1-9(16)12(2)8-20-10(17)6-14-7-11(18)21-13(14,3)4-5-15(12,14)19/h19H,4-8H2,1-3H3/t12-,13+,14+,15+/m0/s1 |
| InChIKey | QTRIFUJLMWOHRH-GBJTYRQASA-N |
| XLogP | 0.75 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |