C34H52O5 — CID 163077384
21,23-dihydroxy-5,8,11,14-tetramethyl-27-propyl-24-oxaheptacyclo[15.8.1.11,23.04,17.05,14.08,13.021,26]heptacos-19-ene-11-carboxylic acid (PubChem CID 163077384) has the molecular formula C34H52O5 and a molecular weight of 540.79 g/mol. Its IUPAC name is 21,23-dihydroxy-5,8,11,14-tetramethyl-27-propyl-24-oxaheptacyclo[15.8.1.11,23.04,17.05,14.08,13.021,26]heptacos-19-ene-11-carboxylic acid.
| Compound Name | 21,23-dihydroxy-5,8,11,14-tetramethyl-27-propyl-24-oxaheptacyclo[15.8.1.11,23.04,17.05,14.08,13.021,26]heptacos-19-ene-11-carboxylic acid |
|---|---|
| PubChem CID | 163077384 |
| Molecular Formula | C34H52O5 |
| Molecular Weight | 540.79 g/mol |
| Exact Mass | 540.38 |
| IUPAC Name | 21,23-dihydroxy-5,8,11,14-tetramethyl-27-propyl-24-oxaheptacyclo[15.8.1.11,23.04,17.05,14.08,13.021,26]heptacos-19-ene-11-carboxylic acid |
| SMILES | CCCC1C2(O)CC3(O)C=CCC45CCC6(C)C7CC(C)(C(=O)O)CCC7(C)CCC6(C)C4CCC1(CO2)C35 |
| InChI | InChI=1S/C34H52O5/c1-6-8-23-32-12-9-22-29(4)16-15-27(2)13-14-28(3,26(35)36)19-24(27)30(29,5)17-18-31(22)10-7-11-33(37,25(31)32)20-34(23,38)39-21-32/h7,11,22-25,37-38H,6,8-10,12-21H2,1-5H3,(H,35,36) |
| InChIKey | KEFJJRMMXHCQED-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.79 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|