C27H28N2O5 — CID 163079392
[(1'S,2R,3'S)-3'-(6-amino-3-pyridinyl)-1'-methyl-7-oxospiro[3H-furo[3,2-g]chromene-2,2'-cyclohexane]-1'-yl] (E)-2-methylbut-2-enoate (PubChem CID 163079392) has the molecular formula C27H28N2O5 and a molecular weight of 460.53 g/mol. Its IUPAC name is [(1'S,2R,3'S)-3'-(6-amino-3-pyridinyl)-1'-methyl-7-oxospiro[3H-furo[3,2-g]chromene-2,2'-cyclohexane]-1'-yl] (E)-2-methylbut-2-enoate.
| Compound Name | [(1'S,2R,3'S)-3'-(6-amino-3-pyridinyl)-1'-methyl-7-oxospiro[3H-furo[3,2-g]chromene-2,2'-cyclohexane]-1'-yl] (E)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 163079392 |
| Molecular Formula | C27H28N2O5 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | [(1'S,2R,3'S)-3'-(6-amino-3-pyridinyl)-1'-methyl-7-oxospiro[3H-furo[3,2-g]chromene-2,2'-cyclohexane]-1'-yl] (E)-2-methylbut-2-enoate |
| SMILES | C/C=C(\C)C(=O)O[C@@]1(C)CCC[C@@H](c2ccc(N)nc2)[C@]12Cc1cc3ccc(=O)oc3cc1O2 |
| InChI | InChI=1S/C27H28N2O5/c1-4-16(2)25(31)34-26(3)11-5-6-20(18-7-9-23(28)29-15-18)27(26)14-19-12-17-8-10-24(30)32-21(17)13-22(19)33-27/h4,7-10,12-13,15,20H,5-6,11,14H2,1-3H3,(H2,28,29)/b16-4+/t20-,26-,27+/m0/s1 |
| InChIKey | NSLGRCVBXGEWIB-UKKKGYNPSA-N |
| XLogP | 4.68 |
| TPSA | 104.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|