C24H36O3 — CID 163081537
(11S)-3-methoxy-2,4,4-trimethyl-9-(4-methylpent-3-enyl)-11-propan-2-ylspiro[5.5]undeca-2,8-diene-1,5-dione (PubChem CID 163081537) has the molecular formula C24H36O3 and a molecular weight of 372.55 g/mol. Its IUPAC name is (11S)-3-methoxy-2,4,4-trimethyl-9-(4-methylpent-3-enyl)-11-propan-2-ylspiro[5.5]undeca-2,8-diene-1,5-dione.
| Compound Name | (11S)-3-methoxy-2,4,4-trimethyl-9-(4-methylpent-3-enyl)-11-propan-2-ylspiro[5.5]undeca-2,8-diene-1,5-dione |
|---|---|
| PubChem CID | 163081537 |
| Molecular Formula | C24H36O3 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | (11S)-3-methoxy-2,4,4-trimethyl-9-(4-methylpent-3-enyl)-11-propan-2-ylspiro[5.5]undeca-2,8-diene-1,5-dione |
| SMILES | COC1=C(C)C(=O)C2(CC=C(CCC=C(C)C)C[C@H]2C(C)C)C(=O)C1(C)C |
| InChI | InChI=1S/C24H36O3/c1-15(2)10-9-11-18-12-13-24(19(14-18)16(3)4)20(25)17(5)21(27-8)23(6,7)22(24)26/h10,12,16,19H,9,11,13-14H2,1-8H3/t19-,24?/m0/s1 |
| InChIKey | BZYZIWKMUTYFDN-XGLRFROISA-N |
| XLogP | 5.81 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|