C19H24O6 — CID 163083914
(1R,2R,3S,7R,8R,13R,15R,16R)-2,3,15-trihydroxy-15-methyl-7-prop-1-en-2-yl-12-oxatetracyclo[8.5.1.02,8.013,16]hexadec-9-ene-5,11-dione (PubChem CID 163083914) has the molecular formula C19H24O6 and a molecular weight of 348.40 g/mol. Its IUPAC name is (1R,2R,3S,7R,8R,13R,15R,16R)-2,3,15-trihydroxy-15-methyl-7-prop-1-en-2-yl-12-oxatetracyclo[8.5.1.02,8.013,16]hexadec-9-ene-5,11-dione.
| Compound Name | (1R,2R,3S,7R,8R,13R,15R,16R)-2,3,15-trihydroxy-15-methyl-7-prop-1-en-2-yl-12-oxatetracyclo[8.5.1.02,8.013,16]hexadec-9-ene-5,11-dione |
|---|---|
| PubChem CID | 163083914 |
| Molecular Formula | C19H24O6 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | (1R,2R,3S,7R,8R,13R,15R,16R)-2,3,15-trihydroxy-15-methyl-7-prop-1-en-2-yl-12-oxatetracyclo[8.5.1.02,8.013,16]hexadec-9-ene-5,11-dione |
| SMILES | C=C(C)[C@@H]1CC(=O)C[C@H](O)[C@@]2(O)[C@@H]1C=C1C(=O)O[C@@H]3C[C@@](C)(O)[C@H]2[C@H]13 |
| InChI | InChI=1S/C19H24O6/c1-8(2)10-4-9(20)5-14(21)19(24)12(10)6-11-15-13(25-17(11)22)7-18(3,23)16(15)19/h6,10,12-16,21,23-24H,1,4-5,7H2,2-3H3/t10-,12+,13+,14-,15+,16+,18+,19-/m0/s1 |
| InChIKey | LGLJIBDNZYKDFW-IURHNJNQSA-N |
| XLogP | 0.50 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|