C19H28O4 — CID 163084507
(1S,4S,8R,9S,10S,13S,15S)-8,15-dihydroxy-5,5,9-trimethyl-14-methylidene-7-oxatetracyclo[11.2.1.01,10.04,9]hexadecan-6-one (PubChem CID 163084507) has the molecular formula C19H28O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is (1S,4S,8R,9S,10S,13S,15S)-8,15-dihydroxy-5,5,9-trimethyl-14-methylidene-7-oxatetracyclo[11.2.1.01,10.04,9]hexadecan-6-one.
| Compound Name | (1S,4S,8R,9S,10S,13S,15S)-8,15-dihydroxy-5,5,9-trimethyl-14-methylidene-7-oxatetracyclo[11.2.1.01,10.04,9]hexadecan-6-one |
|---|---|
| PubChem CID | 163084507 |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | (1S,4S,8R,9S,10S,13S,15S)-8,15-dihydroxy-5,5,9-trimethyl-14-methylidene-7-oxatetracyclo[11.2.1.01,10.04,9]hexadecan-6-one |
| SMILES | C=C1[C@H]2CC[C@H]3[C@](CC[C@@H]4C(C)(C)C(=O)O[C@@H](O)[C@]43C)(C2)[C@H]1O |
| InChI | InChI=1S/C19H28O4/c1-10-11-5-6-13-18(4)12(7-8-19(13,9-11)14(10)20)17(2,3)15(21)23-16(18)22/h11-14,16,20,22H,1,5-9H2,2-4H3/t11-,12+,13+,14-,16+,18+,19-/m0/s1 |
| InChIKey | QINXJSIKYUBGSE-IJKIDAQNSA-N |
| XLogP | 2.64 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|