C19H28O4 — CID 163001721
(1S,4R,8S,9R,10S,13S,14R,16S)-8-hydroxy-5,5,9,14-tetramethyl-7,15-dioxapentacyclo[11.3.1.01,10.04,9.014,16]heptadecan-6-one (PubChem CID 163001721) has the molecular formula C19H28O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is (1S,4R,8S,9R,10S,13S,14R,16S)-8-hydroxy-5,5,9,14-tetramethyl-7,15-dioxapentacyclo[11.3.1.01,10.04,9.014,16]heptadecan-6-one.
| Compound Name | (1S,4R,8S,9R,10S,13S,14R,16S)-8-hydroxy-5,5,9,14-tetramethyl-7,15-dioxapentacyclo[11.3.1.01,10.04,9.014,16]heptadecan-6-one |
|---|---|
| PubChem CID | 163001721 |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | (1S,4R,8S,9R,10S,13S,14R,16S)-8-hydroxy-5,5,9,14-tetramethyl-7,15-dioxapentacyclo[11.3.1.01,10.04,9.014,16]heptadecan-6-one |
| SMILES | CC1(C)C(=O)O[C@H](O)[C@@]2(C)[C@H]1CC[C@]13C[C@H](CC[C@@H]12)[C@@]1(C)O[C@@H]31 |
| InChI | InChI=1S/C19H28O4/c1-16(2)11-7-8-19-9-10(18(4)13(19)23-18)5-6-12(19)17(11,3)15(21)22-14(16)20/h10-13,15,21H,5-9H2,1-4H3/t10-,11-,12+,13+,15-,17-,18+,19-/m0/s1 |
| InChIKey | JEZFFKVMFCDTRK-YQUYBPKFSA-N |
| XLogP | 2.88 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|