C14H22O5 — CID 57258019
3,3,7,7-tetramethyl-4a,7a,8,9,10,11-hexahydro-[1,2,4]trioxino[6,5-j]isochromen-6-one (PubChem CID 57258019) has the molecular formula C14H22O5 and a molecular weight of 270.32 g/mol. Its IUPAC name is 3,3,7,7-tetramethyl-4a,7a,8,9,10,11-hexahydro-[1,2,4]trioxino[6,5-j]isochromen-6-one.
| Compound Name | 3,3,7,7-tetramethyl-4a,7a,8,9,10,11-hexahydro-[1,2,4]trioxino[6,5-j]isochromen-6-one |
|---|---|
| PubChem CID | 57258019 |
| Molecular Formula | C14H22O5 |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 3,3,7,7-tetramethyl-4a,7a,8,9,10,11-hexahydro-[1,2,4]trioxino[6,5-j]isochromen-6-one |
| SMILES | CC1(C)OOC23CCCCC2C(C)(C)C(=O)OC3O1 |
| InChI | InChI=1S/C14H22O5/c1-12(2)9-7-5-6-8-14(9)11(16-10(12)15)17-13(3,4)18-19-14/h9,11H,5-8H2,1-4H3 |
| InChIKey | CUPNOKAOFIVLPA-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|