C14H20O4 — CID 162972026
2-[(1R,2S,3R,6S,8S)-2,3,6-trimethyl-9-oxo-10,11-dioxatricyclo[6.2.1.02,6]undecan-8-yl]acetaldehyde (PubChem CID 162972026) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is 2-[(1R,2S,3R,6S,8S)-2,3,6-trimethyl-9-oxo-10,11-dioxatricyclo[6.2.1.02,6]undecan-8-yl]acetaldehyde.
| Compound Name | 2-[(1R,2S,3R,6S,8S)-2,3,6-trimethyl-9-oxo-10,11-dioxatricyclo[6.2.1.02,6]undecan-8-yl]acetaldehyde |
|---|---|
| PubChem CID | 162972026 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 2-[(1R,2S,3R,6S,8S)-2,3,6-trimethyl-9-oxo-10,11-dioxatricyclo[6.2.1.02,6]undecan-8-yl]acetaldehyde |
| SMILES | C[C@@H]1CC[C@@]2(C)C[C@@]3(CC=O)O[C@H](OC3=O)[C@@]12C |
| InChI | InChI=1S/C14H20O4/c1-9-4-5-12(2)8-14(6-7-15)10(16)17-11(18-14)13(9,12)3/h7,9,11H,4-6,8H2,1-3H3/t9-,11+,12+,13-,14-/m1/s1 |
| InChIKey | AAASSMYLGARPJZ-FYGCWZCISA-N |
| XLogP | 2.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|