C15H20O3 — CID 134977169
(6'R)-2,2-dimethylspiro[1,3-dioxane-5,5'-tricyclo[4.4.0.01,4]dec-2-ene]-4-one (PubChem CID 134977169) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is (6'R)-2,2-dimethylspiro[1,3-dioxane-5,5'-tricyclo[4.4.0.01,4]dec-2-ene]-4-one.
| Compound Name | (6'R)-2,2-dimethylspiro[1,3-dioxane-5,5'-tricyclo[4.4.0.01,4]dec-2-ene]-4-one |
|---|---|
| PubChem CID | 134977169 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (6'R)-2,2-dimethylspiro[1,3-dioxane-5,5'-tricyclo[4.4.0.01,4]dec-2-ene]-4-one |
| SMILES | CC1(C)OCC2(C(=O)O1)C1C=CC13CCCC[C@H]32 |
| InChI | InChI=1S/C15H20O3/c1-13(2)17-9-15(12(16)18-13)10-5-3-4-7-14(10)8-6-11(14)15/h6,8,10-11H,3-5,7,9H2,1-2H3/t10-,11?,14?,15?/m1/s1 |
| InChIKey | GYFPJUYKMHKBKQ-AHNOMFPFSA-N |
| XLogP | 2.66 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|