C30H44O3 — CID 123268857
(1R,4S,5S,8R,9R,12S,16S)-16-hydroxy-5,9,17,17-tetramethyl-8-[(2R)-6-methylhepta-3,5-dien-2-yl]-18-oxapentacyclo[10.5.2.01,13.04,12.05,9]nonadec-2-en-19-one (PubChem CID 123268857) has the molecular formula C30H44O3 and a molecular weight of 452.68 g/mol. Its IUPAC name is (1R,4S,5S,8R,9R,12S,16S)-16-hydroxy-5,9,17,17-tetramethyl-8-[(2R)-6-methylhepta-3,5-dien-2-yl]-18-oxapentacyclo[10.5.2.01,13.04,12.05,9]nonadec-2-en-19-one.
| Compound Name | (1R,4S,5S,8R,9R,12S,16S)-16-hydroxy-5,9,17,17-tetramethyl-8-[(2R)-6-methylhepta-3,5-dien-2-yl]-18-oxapentacyclo[10.5.2.01,13.04,12.05,9]nonadec-2-en-19-one |
|---|---|
| PubChem CID | 123268857 |
| Molecular Formula | C30H44O3 |
| Molecular Weight | 452.68 g/mol |
| Exact Mass | 452.33 |
| IUPAC Name | (1R,4S,5S,8R,9R,12S,16S)-16-hydroxy-5,9,17,17-tetramethyl-8-[(2R)-6-methylhepta-3,5-dien-2-yl]-18-oxapentacyclo[10.5.2.01,13.04,12.05,9]nonadec-2-en-19-one |
| SMILES | CC(C)=CC=C[C@@H](C)[C@H]1CC[C@@]2(C)[C@@H]3C=C[C@@]45OC(=O)[C@]3(CC[C@]12C)C4CC[C@H](O)C5(C)C |
| InChI | InChI=1S/C30H44O3/c1-19(2)9-8-10-20(3)21-13-15-28(7)22-14-16-30-23(11-12-24(31)26(30,4)5)29(22,25(32)33-30)18-17-27(21,28)6/h8-10,14,16,20-24,31H,11-13,15,17-18H2,1-7H3/t20-,21-,22+,23?,24+,27-,28+,29+,30-/m1/s1 |
| InChIKey | QQNWWPSOMQMBLY-YSACVOPXSA-N |
| XLogP | 6.63 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.68 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|