C31H48O4 — CID 134815509
methyl (2E,4E,6R)-6-[(5R,9R,10S,13R,14S,17R)-9-hydroxy-4,4,10,13,14-pentamethyl-3-oxo-2,5,6,7,8,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylhepta-2,4-dienoate (PubChem CID 134815509) has the molecular formula C31H48O4 and a molecular weight of 484.72 g/mol. Its IUPAC name is methyl (2E,4E,6R)-6-[(5R,9R,10S,13R,14S,17R)-9-hydroxy-4,4,10,13,14-pentamethyl-3-oxo-2,5,6,7,8,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylhepta-2,4-dienoate.
| Compound Name | methyl (2E,4E,6R)-6-[(5R,9R,10S,13R,14S,17R)-9-hydroxy-4,4,10,13,14-pentamethyl-3-oxo-2,5,6,7,8,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylhepta-2,4-dienoate |
|---|---|
| PubChem CID | 134815509 |
| Molecular Formula | C31H48O4 |
| Molecular Weight | 484.72 g/mol |
| Exact Mass | 484.36 |
| IUPAC Name | methyl (2E,4E,6R)-6-[(5R,9R,10S,13R,14S,17R)-9-hydroxy-4,4,10,13,14-pentamethyl-3-oxo-2,5,6,7,8,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylhepta-2,4-dienoate |
| SMILES | COC(=O)/C(C)=C/C=C/[C@@H](C)[C@H]1CC[C@@]2(C)C3CC[C@H]4C(C)(C)C(=O)CC[C@]4(C)[C@@]3(O)CC[C@]12C |
| InChI | InChI=1S/C31H48O4/c1-20(10-9-11-21(2)26(33)35-8)22-14-16-29(6)24-13-12-23-27(3,4)25(32)15-17-30(23,7)31(24,34)19-18-28(22,29)5/h9-11,20,22-24,34H,12-19H2,1-8H3/b10-9+,21-11+/t20-,22-,23+,24?,28-,29+,30+,31-/m1/s1 |
| InChIKey | UPWSDOSPRAVERD-RKXSILNUSA-N |
| XLogP | 6.67 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.72 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|