C31H46O6 — CID 72773623
methyl 4-hydroxy-6-(9-hydroxy-4,4,10,13,17-pentamethyl-3,15-dioxo-1,2,5,6,7,11,12,16-octahydrocyclopenta[a]phenanthren-17-yl)-2-methylhept-2-enoate (PubChem CID 72773623) has the molecular formula C31H46O6 and a molecular weight of 514.70 g/mol. Its IUPAC name is methyl 4-hydroxy-6-(9-hydroxy-4,4,10,13,17-pentamethyl-3,15-dioxo-1,2,5,6,7,11,12,16-octahydrocyclopenta[a]phenanthren-17-yl)-2-methylhept-2-enoate.
| Compound Name | methyl 4-hydroxy-6-(9-hydroxy-4,4,10,13,17-pentamethyl-3,15-dioxo-1,2,5,6,7,11,12,16-octahydrocyclopenta[a]phenanthren-17-yl)-2-methylhept-2-enoate |
|---|---|
| PubChem CID | 72773623 |
| Molecular Formula | C31H46O6 |
| Molecular Weight | 514.70 g/mol |
| Exact Mass | 514.33 |
| IUPAC Name | methyl 4-hydroxy-6-(9-hydroxy-4,4,10,13,17-pentamethyl-3,15-dioxo-1,2,5,6,7,11,12,16-octahydrocyclopenta[a]phenanthren-17-yl)-2-methylhept-2-enoate |
| SMILES | COC(=O)C(C)=CC(O)CC(C)C1(C)CC(=O)C2=C3CCC4C(C)(C)C(=O)CCC4(C)C3(O)CCC21C |
| InChI | InChI=1S/C31H46O6/c1-18(26(35)37-8)15-20(32)16-19(2)30(7)17-22(33)25-21-9-10-23-27(3,4)24(34)11-12-28(23,5)31(21,36)14-13-29(25,30)6/h15,19-20,23,32,36H,9-14,16-17H2,1-8H3 |
| InChIKey | ATVYXXWJIBEFNA-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.70 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|