C8H11BrO2 — CID 23250591
(4S,5R)-5-bromo-1-oxaspiro[3.5]nonan-2-one (PubChem CID 23250591) has the molecular formula C8H11BrO2 and a molecular weight of 219.08 g/mol. Its IUPAC name is (4S,5R)-5-bromo-1-oxaspiro[3.5]nonan-2-one.
| Compound Name | (4S,5R)-5-bromo-1-oxaspiro[3.5]nonan-2-one |
|---|---|
| PubChem CID | 23250591 |
| Molecular Formula | C8H11BrO2 |
| Molecular Weight | 219.08 g/mol |
| Exact Mass | 217.99 |
| IUPAC Name | (4S,5R)-5-bromo-1-oxaspiro[3.5]nonan-2-one |
| SMILES | O=C1C[C@]2(CCCC[C@H]2Br)O1 |
| InChI | InChI=1S/C8H11BrO2/c9-6-3-1-2-4-8(6)5-7(10)11-8/h6H,1-5H2/t6-,8+/m1/s1 |
| InChIKey | FKGASWWUBGIHFA-SVRRBLITSA-N |
| XLogP | 2.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.08 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|