C14H19BrO3 — CID 175484768
7a-(1-bromocyclohexyl)-4,5,6,7-tetrahydro-3aH-2-benzofuran-1,3-dione (PubChem CID 175484768) has the molecular formula C14H19BrO3 and a molecular weight of 315.21 g/mol. Its IUPAC name is 7a-(1-bromocyclohexyl)-4,5,6,7-tetrahydro-3aH-2-benzofuran-1,3-dione.
| Compound Name | 7a-(1-bromocyclohexyl)-4,5,6,7-tetrahydro-3aH-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 175484768 |
| Molecular Formula | C14H19BrO3 |
| Molecular Weight | 315.21 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 7a-(1-bromocyclohexyl)-4,5,6,7-tetrahydro-3aH-2-benzofuran-1,3-dione |
| SMILES | O=C1OC(=O)C2(C3(Br)CCCCC3)CCCCC12 |
| InChI | InChI=1S/C14H19BrO3/c15-13(7-3-1-4-8-13)14-9-5-2-6-10(14)11(16)18-12(14)17/h10H,1-9H2 |
| InChIKey | XXFWBUHZGMRFLM-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.21 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|