C10H14O2 — CID 548904
1a,3,4,4a,5,6,7,8-octahydronaphtho[1,8a-b]oxiren-2-one (PubChem CID 548904) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is 1a,3,4,4a,5,6,7,8-octahydronaphtho[1,8a-b]oxiren-2-one.
| Compound Name | 1a,3,4,4a,5,6,7,8-octahydronaphtho[1,8a-b]oxiren-2-one |
|---|---|
| PubChem CID | 548904 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | 1a,3,4,4a,5,6,7,8-octahydronaphtho[1,8a-b]oxiren-2-one |
| SMILES | O=C1CCC2CCCCC23OC13 |
| InChI | InChI=1S/C10H14O2/c11-8-5-4-7-3-1-2-6-10(7)9(8)12-10/h7,9H,1-6H2 |
| InChIKey | JVMSASFPATYJOI-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|