C12H16O3 — CID 146166125
(1S,6R,7S)-13-oxatricyclo[5.4.2.01,6]tridecane-5,12-dione (PubChem CID 146166125) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is (1S,6R,7S)-13-oxatricyclo[5.4.2.01,6]tridecane-5,12-dione.
| Compound Name | (1S,6R,7S)-13-oxatricyclo[5.4.2.01,6]tridecane-5,12-dione |
|---|---|
| PubChem CID | 146166125 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | (1S,6R,7S)-13-oxatricyclo[5.4.2.01,6]tridecane-5,12-dione |
| SMILES | O=C1CCC[C@]23CCCC[C@H](OC2=O)[C@H]13 |
| InChI | InChI=1S/C12H16O3/c13-8-4-3-7-12-6-2-1-5-9(10(8)12)15-11(12)14/h9-10H,1-7H2/t9-,10-,12-/m0/s1 |
| InChIKey | MYEOWNOFDQWZCV-NHCYSSNCSA-N |
| XLogP | 1.84 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |