C16H18O4 — CID 101157260
(1S,10R)-spiro[12,13-dioxatricyclo[8.2.1.01,6]tridecane-11,4'-cyclohexa-2,5-diene]-1',9-dione (PubChem CID 101157260) has the molecular formula C16H18O4 and a molecular weight of 274.32 g/mol. Its IUPAC name is (1S,10R)-spiro[12,13-dioxatricyclo[8.2.1.01,6]tridecane-11,4'-cyclohexa-2,5-diene]-1',9-dione.
| Compound Name | (1S,10R)-spiro[12,13-dioxatricyclo[8.2.1.01,6]tridecane-11,4'-cyclohexa-2,5-diene]-1',9-dione |
|---|---|
| PubChem CID | 101157260 |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | (1S,10R)-spiro[12,13-dioxatricyclo[8.2.1.01,6]tridecane-11,4'-cyclohexa-2,5-diene]-1',9-dione |
| SMILES | O=C1C=CC2(C=C1)O[C@@]13CCCCC1CCC(=O)[C@@H]2O3 |
| InChI | InChI=1S/C16H18O4/c17-12-6-9-15(10-7-12)14-13(18)5-4-11-3-1-2-8-16(11,19-14)20-15/h6-7,9-11,14H,1-5,8H2/t11?,14-,16-/m0/s1 |
| InChIKey | XPZYTCWHNYRIQL-VYIWWYPRSA-N |
| XLogP | 2.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |