C38H34O2 — CID 10962404
(1S,6R,9S)-1',2',3',4'-tetraphenylspiro[11,12-dioxatricyclo[7.2.1.01,6]dodecane-10,5'-cyclopenta-1,3-diene] (PubChem CID 10962404) has the molecular formula C38H34O2 and a molecular weight of 522.69 g/mol. Its IUPAC name is (1S,6R,9S)-1',2',3',4'-tetraphenylspiro[11,12-dioxatricyclo[7.2.1.01,6]dodecane-10,5'-cyclopenta-1,3-diene].
| Compound Name | (1S,6R,9S)-1',2',3',4'-tetraphenylspiro[11,12-dioxatricyclo[7.2.1.01,6]dodecane-10,5'-cyclopenta-1,3-diene] |
|---|---|
| PubChem CID | 10962404 |
| Molecular Formula | C38H34O2 |
| Molecular Weight | 522.69 g/mol |
| Exact Mass | 522.26 |
| IUPAC Name | (1S,6R,9S)-1',2',3',4'-tetraphenylspiro[11,12-dioxatricyclo[7.2.1.01,6]dodecane-10,5'-cyclopenta-1,3-diene] |
| SMILES | c1ccc(C2=C(c3ccccc3)C3(O[C@@]45CCCC[C@@H]4CC[C@@H]3O5)C(c3ccccc3)=C2c2ccccc2)cc1 |
| InChI | InChI=1S/C38H34O2/c1-5-15-27(16-6-1)33-34(28-17-7-2-8-18-28)36(30-21-11-4-12-22-30)38(35(33)29-19-9-3-10-20-29)32-25-24-31-23-13-14-26-37(31,39-32)40-38/h1-12,15-22,31-32H,13-14,23-26H2/t31-,32+,37+/m1/s1 |
| InChIKey | ARWHXVSMATXNEU-PRMRKMRISA-N |
| XLogP | 9.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.69 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|