C16H14O2 — CID 15701388
4-phenylspiro[4.5]deca-6,9-diene-3,8-dione (PubChem CID 15701388) has the molecular formula C16H14O2 and a molecular weight of 238.29 g/mol. Its IUPAC name is 4-phenylspiro[4.5]deca-6,9-diene-3,8-dione.
| Compound Name | 4-phenylspiro[4.5]deca-6,9-diene-3,8-dione |
|---|---|
| PubChem CID | 15701388 |
| Molecular Formula | C16H14O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 4-phenylspiro[4.5]deca-6,9-diene-3,8-dione |
| SMILES | O=C1C=CC2(C=C1)CCC(=O)C2c1ccccc1 |
| InChI | InChI=1S/C16H14O2/c17-13-6-9-16(10-7-13)11-8-14(18)15(16)12-4-2-1-3-5-12/h1-7,9-10,15H,8,11H2 |
| InChIKey | AOHMZMSCUOGZAM-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |