C31H44O14 — CID 163088891
[(1S,2S,3R,4S,8S,9R,10R,13R,14S,15R,16R)-2,3,14,15-tetraacetyloxy-9-hydroxy-4-(2-hydroxypropan-2-yl)-9,14-dimethyl-6-oxo-5-oxatetracyclo[11.2.1.01,10.04,8]hexadecan-16-yl] propanoate (PubChem CID 163088891) has the molecular formula C31H44O14 and a molecular weight of 640.68 g/mol. Its IUPAC name is [(1S,2S,3R,4S,8S,9R,10R,13R,14S,15R,16R)-2,3,14,15-tetraacetyloxy-9-hydroxy-4-(2-hydroxypropan-2-yl)-9,14-dimethyl-6-oxo-5-oxatetracyclo[11.2.1.01,10.04,8]hexadecan-16-yl] propanoate.
| Compound Name | [(1S,2S,3R,4S,8S,9R,10R,13R,14S,15R,16R)-2,3,14,15-tetraacetyloxy-9-hydroxy-4-(2-hydroxypropan-2-yl)-9,14-dimethyl-6-oxo-5-oxatetracyclo[11.2.1.01,10.04,8]hexadecan-16-yl] propanoate |
|---|---|
| PubChem CID | 163088891 |
| Molecular Formula | C31H44O14 |
| Molecular Weight | 640.68 g/mol |
| Exact Mass | 640.27 |
| IUPAC Name | [(1S,2S,3R,4S,8S,9R,10R,13R,14S,15R,16R)-2,3,14,15-tetraacetyloxy-9-hydroxy-4-(2-hydroxypropan-2-yl)-9,14-dimethyl-6-oxo-5-oxatetracyclo[11.2.1.01,10.04,8]hexadecan-16-yl] propanoate |
| SMILES | CCC(=O)O[C@@H]1[C@H]2CC[C@H]3[C@@](C)(O)[C@@H]4CC(=O)O[C@]4(C(C)(C)O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@]13[C@@H](OC(C)=O)[C@@]2(C)OC(C)=O |
| InChI | InChI=1S/C31H44O14/c1-10-21(36)43-23-18-11-12-19-28(8,39)20-13-22(37)45-31(20,27(6,7)38)25(41-15(3)33)24(40-14(2)32)30(19,23)26(42-16(4)34)29(18,9)44-17(5)35/h18-20,23-26,38-39H,10-13H2,1-9H3/t18-,19+,20+,23-,24-,25-,26+,28-,29+,30+,31+/m1/s1 |
| InChIKey | CIHLLEHSMQTHHZ-SPXDQWLKSA-N |
| XLogP | 1.29 |
| TPSA | 198.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.68 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|