C33H35N3O8 — CID 163090529
6-acetyl-7,9-dihydroxy-8,9b-dimethyl-2-[1-[[4-oxo-4-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)butyl]amino]ethylidene]dibenzofuran-1,3-dione (PubChem CID 163090529) has the molecular formula C33H35N3O8 and a molecular weight of 601.66 g/mol. Its IUPAC name is 6-acetyl-7,9-dihydroxy-8,9b-dimethyl-2-[1-[[4-oxo-4-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)butyl]amino]ethylidene]dibenzofuran-1,3-dione.
| Compound Name | 6-acetyl-7,9-dihydroxy-8,9b-dimethyl-2-[1-[[4-oxo-4-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)butyl]amino]ethylidene]dibenzofuran-1,3-dione |
|---|---|
| PubChem CID | 163090529 |
| Molecular Formula | C33H35N3O8 |
| Molecular Weight | 601.66 g/mol |
| Exact Mass | 601.24 |
| IUPAC Name | 6-acetyl-7,9-dihydroxy-8,9b-dimethyl-2-[1-[[4-oxo-4-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)butyl]amino]ethylidene]dibenzofuran-1,3-dione |
| SMILES | CC(=O)c1c(O)c(C)c(O)c2c1OC1=CC(=O)C(=C(C)NCCCC(=O)N3CC4CC(C3)c3cccc(=O)n3C4)C(=O)C12C |
| InChI | InChI=1S/C33H35N3O8/c1-16-29(41)27(18(3)37)31-28(30(16)42)33(4)23(44-31)12-22(38)26(32(33)43)17(2)34-10-6-9-24(39)35-13-19-11-20(15-35)21-7-5-8-25(40)36(21)14-19/h5,7-8,12,19-20,34,41-42H,6,9-11,13-15H2,1-4H3 |
| InChIKey | GZPQCQIMBUUENJ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 155.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.66 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|