C24H39NO8 — CID 163092008
(1R,2S,3S,4S,5R,6S,8R,9R,10S,13S,16S,17R,18S)-11-ethyl-13-(hydroxymethyl)-4,6,18-trimethoxy-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-2,8,9,16-tetrol (PubChem CID 163092008) has the molecular formula C24H39NO8 and a molecular weight of 469.58 g/mol. Its IUPAC name is (1R,2S,3S,4S,5R,6S,8R,9R,10S,13S,16S,17R,18S)-11-ethyl-13-(hydroxymethyl)-4,6,18-trimethoxy-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-2,8,9,16-tetrol.
| Compound Name | (1R,2S,3S,4S,5R,6S,8R,9R,10S,13S,16S,17R,18S)-11-ethyl-13-(hydroxymethyl)-4,6,18-trimethoxy-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-2,8,9,16-tetrol |
|---|---|
| PubChem CID | 163092008 |
| Molecular Formula | C24H39NO8 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.27 |
| IUPAC Name | (1R,2S,3S,4S,5R,6S,8R,9R,10S,13S,16S,17R,18S)-11-ethyl-13-(hydroxymethyl)-4,6,18-trimethoxy-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-2,8,9,16-tetrol |
| SMILES | CCN1C[C@]2(CO)CC[C@H](O)[C@@]34[C@@H]2[C@H](OC)[C@](O)([C@@H]13)[C@@]1(O)C[C@H](OC)[C@H]2C[C@]4(O)[C@@H]1[C@H]2OC |
| InChI | InChI=1S/C24H39NO8/c1-5-25-10-20(11-26)7-6-14(27)23-17(20)18(33-4)24(30,19(23)25)22(29)9-13(31-2)12-8-21(23,28)16(22)15(12)32-3/h12-19,26-30H,5-11H2,1-4H3/t12-,13+,14+,15+,16+,17-,18+,19+,20+,21+,22-,23-,24+/m1/s1 |
| InChIKey | PZXMPFHLRJDPFF-OACALLPGSA-N |
| XLogP | -1.27 |
| TPSA | 132.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |