C33H60O3 — CID 163093764
[(2Z,7S,9R)-9-hydroxy-3,7,11-trimethyldodeca-2,10-dienyl] (Z)-octadec-9-enoate (PubChem CID 163093764) has the molecular formula C33H60O3 and a molecular weight of 504.84 g/mol. Its IUPAC name is [(2Z,7S,9R)-9-hydroxy-3,7,11-trimethyldodeca-2,10-dienyl] (Z)-octadec-9-enoate.
| Compound Name | [(2Z,7S,9R)-9-hydroxy-3,7,11-trimethyldodeca-2,10-dienyl] (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 163093764 |
| Molecular Formula | C33H60O3 |
| Molecular Weight | 504.84 g/mol |
| Exact Mass | 504.45 |
| IUPAC Name | [(2Z,7S,9R)-9-hydroxy-3,7,11-trimethyldodeca-2,10-dienyl] (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC/C=C(/C)CCC[C@H](C)C[C@@H](O)C=C(C)C |
| InChI | InChI=1S/C33H60O3/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24-33(35)36-26-25-30(4)22-21-23-31(5)28-32(34)27-29(2)3/h13-14,25,27,31-32,34H,6-12,15-24,26,28H2,1-5H3/b14-13-,30-25-/t31-,32-/m0/s1 |
| InChIKey | JQRCVVVXUVVPQP-JNUNPHRLSA-N |
| XLogP | 10.04 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.84 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|