C14H18O4 — CID 163094581
(1S,2S,4R,7Z,11S)-4,8-dimethyl-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-ene-9,13-dione (PubChem CID 163094581) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is (1S,2S,4R,7Z,11S)-4,8-dimethyl-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-ene-9,13-dione.
| Compound Name | (1S,2S,4R,7Z,11S)-4,8-dimethyl-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-ene-9,13-dione |
|---|---|
| PubChem CID | 163094581 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | (1S,2S,4R,7Z,11S)-4,8-dimethyl-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-ene-9,13-dione |
| SMILES | C/C1=C/CC[C@@]2(C)O[C@H]2[C@H]2OC(=O)C[C@@H]2CC1=O |
| InChI | InChI=1S/C14H18O4/c1-8-4-3-5-14(2)13(18-14)12-9(6-10(8)15)7-11(16)17-12/h4,9,12-13H,3,5-7H2,1-2H3/b8-4-/t9-,12-,13-,14+/m0/s1 |
| InChIKey | ZUVUFMKEYMFMJG-MUOCZLSKSA-N |
| XLogP | 1.77 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|