C30H46O2 — CID 163097246
1,2,6,6,10,15,19-heptamethyl-21-oxahexacyclo[12.10.0.02,11.05,10.015,22.018,22]tetracos-7-en-9-one (PubChem CID 163097246) has the molecular formula C30H46O2 and a molecular weight of 438.70 g/mol. Its IUPAC name is 1,2,6,6,10,15,19-heptamethyl-21-oxahexacyclo[12.10.0.02,11.05,10.015,22.018,22]tetracos-7-en-9-one.
| Compound Name | 1,2,6,6,10,15,19-heptamethyl-21-oxahexacyclo[12.10.0.02,11.05,10.015,22.018,22]tetracos-7-en-9-one |
|---|---|
| PubChem CID | 163097246 |
| Molecular Formula | C30H46O2 |
| Molecular Weight | 438.70 g/mol |
| Exact Mass | 438.35 |
| IUPAC Name | 1,2,6,6,10,15,19-heptamethyl-21-oxahexacyclo[12.10.0.02,11.05,10.015,22.018,22]tetracos-7-en-9-one |
| SMILES | CC1COC23CCC4(C)C(CCC5C6(C)C(=O)C=CC(C)(C)C6CCC54C)C2(C)CCC13 |
| InChI | InChI=1S/C30H46O2/c1-19-18-32-30-17-16-27(5)22(28(30,6)14-10-20(19)30)8-9-23-26(27,4)15-11-21-25(2,3)13-12-24(31)29(21,23)7/h12-13,19-23H,8-11,14-18H2,1-7H3 |
| InChIKey | VOCLEAMVINKHOU-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.70 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |