C22H40O10 — CID 163098478
6-[[5,8-dihydroxy-2-(2-hydroxypropan-2-yl)-4a,8-dimethyl-1,2,3,4,5,6,7,8a-octahydronaphthalen-1-yl]peroxy]-2-(hydroxymethyl)-2-methyloxane-3,4,5-triol (PubChem CID 163098478) has the molecular formula C22H40O10 and a molecular weight of 464.55 g/mol. Its IUPAC name is 6-[[5,8-dihydroxy-2-(2-hydroxypropan-2-yl)-4a,8-dimethyl-1,2,3,4,5,6,7,8a-octahydronaphthalen-1-yl]peroxy]-2-(hydroxymethyl)-2-methyloxane-3,4,5-triol.
| Compound Name | 6-[[5,8-dihydroxy-2-(2-hydroxypropan-2-yl)-4a,8-dimethyl-1,2,3,4,5,6,7,8a-octahydronaphthalen-1-yl]peroxy]-2-(hydroxymethyl)-2-methyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 163098478 |
| Molecular Formula | C22H40O10 |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.26 |
| IUPAC Name | 6-[[5,8-dihydroxy-2-(2-hydroxypropan-2-yl)-4a,8-dimethyl-1,2,3,4,5,6,7,8a-octahydronaphthalen-1-yl]peroxy]-2-(hydroxymethyl)-2-methyloxane-3,4,5-triol |
| SMILES | CC(C)(O)C1CCC2(C)C(O)CCC(C)(O)C2C1OOC1OC(C)(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C22H40O10/c1-19(2,28)11-6-8-20(3)12(24)7-9-21(4,29)16(20)15(11)31-32-18-14(26)13(25)17(27)22(5,10-23)30-18/h11-18,23-29H,6-10H2,1-5H3 |
| InChIKey | DVHOYPKTBJPTSW-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 169.30 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|