C25H42O2 — CID 163098599
(1R,3S,7S,8R,11S,12R)-12-[(4S)-4-hydroxy-6-methylhept-1-en-2-yl]-1,4,8-trimethyltricyclo[9.3.0.03,7]tetradec-4-en-8-ol (PubChem CID 163098599) has the molecular formula C25H42O2 and a molecular weight of 374.61 g/mol. Its IUPAC name is (1R,3S,7S,8R,11S,12R)-12-[(4S)-4-hydroxy-6-methylhept-1-en-2-yl]-1,4,8-trimethyltricyclo[9.3.0.03,7]tetradec-4-en-8-ol.
| Compound Name | (1R,3S,7S,8R,11S,12R)-12-[(4S)-4-hydroxy-6-methylhept-1-en-2-yl]-1,4,8-trimethyltricyclo[9.3.0.03,7]tetradec-4-en-8-ol |
|---|---|
| PubChem CID | 163098599 |
| Molecular Formula | C25H42O2 |
| Molecular Weight | 374.61 g/mol |
| Exact Mass | 374.32 |
| IUPAC Name | (1R,3S,7S,8R,11S,12R)-12-[(4S)-4-hydroxy-6-methylhept-1-en-2-yl]-1,4,8-trimethyltricyclo[9.3.0.03,7]tetradec-4-en-8-ol |
| SMILES | C=C(C[C@@H](O)CC(C)C)[C@@H]1CC[C@]2(C)C[C@@H]3C(C)=CC[C@@H]3[C@](C)(O)CC[C@@H]12 |
| InChI | InChI=1S/C25H42O2/c1-16(2)13-19(26)14-18(4)20-9-11-24(5)15-21-17(3)7-8-23(21)25(6,27)12-10-22(20)24/h7,16,19-23,26-27H,4,8-15H2,1-3,5-6H3/t19-,20-,21+,22-,23-,24+,25+/m0/s1 |
| InChIKey | ZTTPPDZFKVLMFX-YCHLROQCSA-N |
| XLogP | 5.89 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.61 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|