C25H40O5 — CID 169491975
(2S)-2-[(1S,2Z,5R,6R,9S,11R,12S,14E,16R)-11,12,16-trihydroxy-2,9,12,16-tetramethyl-6-tricyclo[13.3.0.05,9]octadeca-2,14-dienyl]propanoic acid (PubChem CID 169491975) has the molecular formula C25H40O5 and a molecular weight of 420.59 g/mol. Its IUPAC name is (2S)-2-[(1S,2Z,5R,6R,9S,11R,12S,14E,16R)-11,12,16-trihydroxy-2,9,12,16-tetramethyl-6-tricyclo[13.3.0.05,9]octadeca-2,14-dienyl]propanoic acid.
| Compound Name | (2S)-2-[(1S,2Z,5R,6R,9S,11R,12S,14E,16R)-11,12,16-trihydroxy-2,9,12,16-tetramethyl-6-tricyclo[13.3.0.05,9]octadeca-2,14-dienyl]propanoic acid |
|---|---|
| PubChem CID | 169491975 |
| Molecular Formula | C25H40O5 |
| Molecular Weight | 420.59 g/mol |
| Exact Mass | 420.29 |
| IUPAC Name | (2S)-2-[(1S,2Z,5R,6R,9S,11R,12S,14E,16R)-11,12,16-trihydroxy-2,9,12,16-tetramethyl-6-tricyclo[13.3.0.05,9]octadeca-2,14-dienyl]propanoic acid |
| SMILES | C/C1=C/C[C@@H]2[C@H]([C@H](C)C(=O)O)CC[C@@]2(C)C[C@@H](O)[C@@](C)(O)C/C=C2\[C@H]1CC[C@@]2(C)O |
| InChI | InChI=1S/C25H40O5/c1-15-6-7-19-18(16(2)22(27)28)8-11-23(19,3)14-21(26)25(5,30)13-10-20-17(15)9-12-24(20,4)29/h6,10,16-19,21,26,29-30H,7-9,11-14H2,1-5H3,(H,27,28)/b15-6-,20-10+/t16-,17-,18-,19+,21+,23-,24+,25-/m0/s1 |
| InChIKey | BKGYJGMVRKCUQI-GNISQIFWSA-N |
| XLogP | 4.07 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.59 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|