C13H10O — CID 163102685
(2R,3S)-2-ethenyl-3-[(E)-non-1-en-3,5,7-triynyl]oxirane (PubChem CID 163102685) has the molecular formula C13H10O and a molecular weight of 182.22 g/mol. Its IUPAC name is (2R,3S)-2-ethenyl-3-[(E)-non-1-en-3,5,7-triynyl]oxirane.
| Compound Name | (2R,3S)-2-ethenyl-3-[(E)-non-1-en-3,5,7-triynyl]oxirane |
|---|---|
| PubChem CID | 163102685 |
| Molecular Formula | C13H10O |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | (2R,3S)-2-ethenyl-3-[(E)-non-1-en-3,5,7-triynyl]oxirane |
| SMILES | C=C[C@H]1O[C@H]1/C=C/C#CC#CC#CC |
| InChI | InChI=1S/C13H10O/c1-3-5-6-7-8-9-10-11-13-12(4-2)14-13/h4,10-13H,2H2,1H3/b11-10+/t12-,13+/m1/s1 |
| InChIKey | ZJMXHGIVVFPAJY-NQYVGZPUSA-N |
| XLogP | 1.53 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|