C18H28O4 — CID 163103644
(E)-9-oxo-11-[(2R,3R)-3-[(Z)-pent-2-enyl]oxiran-2-yl]undec-10-enoic acid (PubChem CID 163103644) has the molecular formula C18H28O4 and a molecular weight of 308.42 g/mol. Its IUPAC name is (E)-9-oxo-11-[(2R,3R)-3-[(Z)-pent-2-enyl]oxiran-2-yl]undec-10-enoic acid.
| Compound Name | (E)-9-oxo-11-[(2R,3R)-3-[(Z)-pent-2-enyl]oxiran-2-yl]undec-10-enoic acid |
|---|---|
| PubChem CID | 163103644 |
| Molecular Formula | C18H28O4 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | (E)-9-oxo-11-[(2R,3R)-3-[(Z)-pent-2-enyl]oxiran-2-yl]undec-10-enoic acid |
| SMILES | CC/C=C\C[C@H]1O[C@@H]1/C=C/C(=O)CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H28O4/c1-2-3-7-11-16-17(22-16)14-13-15(19)10-8-5-4-6-9-12-18(20)21/h3,7,13-14,16-17H,2,4-6,8-12H2,1H3,(H,20,21)/b7-3-,14-13+/t16-,17-/m1/s1 |
| InChIKey | CDAFZIZCSMXWHY-IQWQWEDASA-N |
| XLogP | 4.05 |
| TPSA | 66.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|