C30H52N2O3 — CID 163103655
(2R,3S,4Z,7S,8E,11Z,14Z,17Z,20Z,28S,29R)-2,29-diaminotriaconta-4,8,11,14,17,20-hexaene-3,7,28-triol (PubChem CID 163103655) has the molecular formula C30H52N2O3 and a molecular weight of 488.76 g/mol. Its IUPAC name is (2R,3S,4Z,7S,8E,11Z,14Z,17Z,20Z,28S,29R)-2,29-diaminotriaconta-4,8,11,14,17,20-hexaene-3,7,28-triol.
| Compound Name | (2R,3S,4Z,7S,8E,11Z,14Z,17Z,20Z,28S,29R)-2,29-diaminotriaconta-4,8,11,14,17,20-hexaene-3,7,28-triol |
|---|---|
| PubChem CID | 163103655 |
| Molecular Formula | C30H52N2O3 |
| Molecular Weight | 488.76 g/mol |
| Exact Mass | 488.40 |
| IUPAC Name | (2R,3S,4Z,7S,8E,11Z,14Z,17Z,20Z,28S,29R)-2,29-diaminotriaconta-4,8,11,14,17,20-hexaene-3,7,28-triol |
| SMILES | C[C@@H](N)[C@@H](O)/C=C\C[C@H](O)/C=C/C/C=C\C/C=C\C/C=C\C/C=C\CCCCCC[C@H](O)[C@@H](C)N |
| InChI | InChI=1S/C30H52N2O3/c1-26(31)29(34)24-20-18-16-14-12-10-8-6-4-3-5-7-9-11-13-15-17-19-22-28(33)23-21-25-30(35)27(2)32/h3-4,7-10,13,15,19,21-22,25-30,33-35H,5-6,11-12,14,16-18,20,23-24,31-32H2,1-2H3/b4-3-,9-7-,10-8-,15-13-,22-19+,25-21-/t26-,27-,28-,29+,30+/m1/s1 |
| InChIKey | CERUMKGEJQXNCI-VNTPILRTSA-N |
| XLogP | 5.39 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.76 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|