C22H24N2O6 — CID 163104506
methyl 13-ethylidene-17-hydroxy-4,6-dimethoxy-16-oxa-8,15-diazahexacyclo[10.6.1.01,9.02,7.010,15.014,18]nonadeca-2(7),3,5,8-tetraene-19-carboxylate (PubChem CID 163104506) has the molecular formula C22H24N2O6 and a molecular weight of 412.44 g/mol. Its IUPAC name is methyl 13-ethylidene-17-hydroxy-4,6-dimethoxy-16-oxa-8,15-diazahexacyclo[10.6.1.01,9.02,7.010,15.014,18]nonadeca-2(7),3,5,8-tetraene-19-carboxylate.
| Compound Name | methyl 13-ethylidene-17-hydroxy-4,6-dimethoxy-16-oxa-8,15-diazahexacyclo[10.6.1.01,9.02,7.010,15.014,18]nonadeca-2(7),3,5,8-tetraene-19-carboxylate |
|---|---|
| PubChem CID | 163104506 |
| Molecular Formula | C22H24N2O6 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | methyl 13-ethylidene-17-hydroxy-4,6-dimethoxy-16-oxa-8,15-diazahexacyclo[10.6.1.01,9.02,7.010,15.014,18]nonadeca-2(7),3,5,8-tetraene-19-carboxylate |
| SMILES | CC=C1C2CC3C4=Nc5c(OC)cc(OC)cc5C4(C2C(=O)OC)C2C(O)ON3C12 |
| InChI | InChI=1S/C22H24N2O6/c1-5-10-11-8-13-19-22(15(11)20(25)29-4,16-18(10)24(13)30-21(16)26)12-6-9(27-2)7-14(28-3)17(12)23-19/h5-7,11,13,15-16,18,21,26H,8H2,1-4H3 |
| InChIKey | IZJXWXGTDBFHQB-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 89.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|