C22H24N2O6 — CID 163021083
methyl (1R,10S,12R,13Z,14S,17R,18S,19R)-13-ethylidene-17-hydroxy-4,5-dimethoxy-16-oxa-8,15-diazahexacyclo[10.6.1.01,9.02,7.010,15.014,18]nonadeca-2,4,6,8-tetraene-19-carboxylate (PubChem CID 163021083) has the molecular formula C22H24N2O6 and a molecular weight of 412.44 g/mol. Its IUPAC name is methyl (1R,10S,12R,13Z,14S,17R,18S,19R)-13-ethylidene-17-hydroxy-4,5-dimethoxy-16-oxa-8,15-diazahexacyclo[10.6.1.01,9.02,7.010,15.014,18]nonadeca-2,4,6,8-tetraene-19-carboxylate.
| Compound Name | methyl (1R,10S,12R,13Z,14S,17R,18S,19R)-13-ethylidene-17-hydroxy-4,5-dimethoxy-16-oxa-8,15-diazahexacyclo[10.6.1.01,9.02,7.010,15.014,18]nonadeca-2,4,6,8-tetraene-19-carboxylate |
|---|---|
| PubChem CID | 163021083 |
| Molecular Formula | C22H24N2O6 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | methyl (1R,10S,12R,13Z,14S,17R,18S,19R)-13-ethylidene-17-hydroxy-4,5-dimethoxy-16-oxa-8,15-diazahexacyclo[10.6.1.01,9.02,7.010,15.014,18]nonadeca-2,4,6,8-tetraene-19-carboxylate |
| SMILES | C/C=C1\[C@@H]2[C@H]3[C@H](O)ON2[C@H]2C[C@@H]1[C@@H](C(=O)OC)[C@]31C2=Nc2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C22H24N2O6/c1-5-9-10-6-13-19-22(16(10)20(25)29-4,17-18(9)24(13)30-21(17)26)11-7-14(27-2)15(28-3)8-12(11)23-19/h5,7-8,10,13,16-18,21,26H,6H2,1-4H3/b9-5-/t10-,13-,16-,17-,18+,21+,22-/m0/s1 |
| InChIKey | WDGIAEBXIRAMKS-PDFOBUJOSA-N |
| XLogP | 1.73 |
| TPSA | 89.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|