C20H24N2O4 — CID 177410515
methyl (1R,10S,12R,13E,14R,15R,16R)-13-ethylidene-11-hydroxy-16-(hydroxymethyl)-8,11-diazapentacyclo[10.3.1.110,14.01,9.02,7]heptadeca-2,4,6-triene-15-carboxylate (PubChem CID 177410515) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is methyl (1R,10S,12R,13E,14R,15R,16R)-13-ethylidene-11-hydroxy-16-(hydroxymethyl)-8,11-diazapentacyclo[10.3.1.110,14.01,9.02,7]heptadeca-2,4,6-triene-15-carboxylate.
| Compound Name | methyl (1R,10S,12R,13E,14R,15R,16R)-13-ethylidene-11-hydroxy-16-(hydroxymethyl)-8,11-diazapentacyclo[10.3.1.110,14.01,9.02,7]heptadeca-2,4,6-triene-15-carboxylate |
|---|---|
| PubChem CID | 177410515 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | methyl (1R,10S,12R,13E,14R,15R,16R)-13-ethylidene-11-hydroxy-16-(hydroxymethyl)-8,11-diazapentacyclo[10.3.1.110,14.01,9.02,7]heptadeca-2,4,6-triene-15-carboxylate |
| SMILES | C/C=C1\[C@@H]2C[C@H]3C4Nc5ccccc5[C@]4([C@@H]2C(=O)OC)[C@@H](CO)[C@H]1N3O |
| InChI | InChI=1S/C20H24N2O4/c1-3-10-11-8-15-18-20(16(11)19(24)26-2,13(9-23)17(10)22(15)25)12-6-4-5-7-14(12)21-18/h3-7,11,13,15-18,21,23,25H,8-9H2,1-2H3/b10-3+/t11-,13-,15-,16-,17-,18?,20+/m0/s1 |
| InChIKey | UNLSBAHHXHIGLJ-MDJSDTJNSA-N |
| XLogP | 1.54 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|