C23H26N2O5 — CID 163185768
methyl (1R,2E,7S,8S,10S)-7-(6,7-dimethoxyquinolin-4-yl)-2-ethylidene-6-oxa-4-azatricyclo[5.2.1.04,8]decane-10-carboxylate (PubChem CID 163185768) has the molecular formula C23H26N2O5 and a molecular weight of 410.47 g/mol. Its IUPAC name is methyl (1R,2E,7S,8S,10S)-7-(6,7-dimethoxyquinolin-4-yl)-2-ethylidene-6-oxa-4-azatricyclo[5.2.1.04,8]decane-10-carboxylate.
| Compound Name | methyl (1R,2E,7S,8S,10S)-7-(6,7-dimethoxyquinolin-4-yl)-2-ethylidene-6-oxa-4-azatricyclo[5.2.1.04,8]decane-10-carboxylate |
|---|---|
| PubChem CID | 163185768 |
| Molecular Formula | C23H26N2O5 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | methyl (1R,2E,7S,8S,10S)-7-(6,7-dimethoxyquinolin-4-yl)-2-ethylidene-6-oxa-4-azatricyclo[5.2.1.04,8]decane-10-carboxylate |
| SMILES | C/C=C1/CN2CO[C@@]3(c4ccnc5cc(OC)c(OC)cc45)[C@@H]2C[C@@H]1[C@@H]3C(=O)OC |
| InChI | InChI=1S/C23H26N2O5/c1-5-13-11-25-12-30-23(20(25)9-14(13)21(23)22(26)29-4)16-6-7-24-17-10-19(28-3)18(27-2)8-15(16)17/h5-8,10,14,20-21H,9,11-12H2,1-4H3/b13-5-/t14-,20-,21+,23-/m0/s1 |
| InChIKey | TUICENXFLOTBCM-FMWCBSDMSA-N |
| XLogP | 2.87 |
| TPSA | 70.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|