C24H35NO4 — CID 163104854
[(1R,5R,8R,10R,11R,12S,14S,16R,17R)-7-(2-hydroxyethyl)-5-methyl-13-methylidene-9-oxa-7-azahexacyclo[8.6.2.211,14.01,8.05,17.011,16]icosan-12-yl] acetate (PubChem CID 163104854) has the molecular formula C24H35NO4 and a molecular weight of 401.55 g/mol. Its IUPAC name is [(1R,5R,8R,10R,11R,12S,14S,16R,17R)-7-(2-hydroxyethyl)-5-methyl-13-methylidene-9-oxa-7-azahexacyclo[8.6.2.211,14.01,8.05,17.011,16]icosan-12-yl] acetate.
| Compound Name | [(1R,5R,8R,10R,11R,12S,14S,16R,17R)-7-(2-hydroxyethyl)-5-methyl-13-methylidene-9-oxa-7-azahexacyclo[8.6.2.211,14.01,8.05,17.011,16]icosan-12-yl] acetate |
|---|---|
| PubChem CID | 163104854 |
| Molecular Formula | C24H35NO4 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.26 |
| IUPAC Name | [(1R,5R,8R,10R,11R,12S,14S,16R,17R)-7-(2-hydroxyethyl)-5-methyl-13-methylidene-9-oxa-7-azahexacyclo[8.6.2.211,14.01,8.05,17.011,16]icosan-12-yl] acetate |
| SMILES | C=C1[C@H]2CC[C@]3([C@@H](C2)[C@]24CCC[C@@]5(C)CN(CCO)[C@@H]2O[C@@H]3C[C@H]54)[C@H]1OC(C)=O |
| InChI | InChI=1S/C24H35NO4/c1-14-16-5-8-24(20(14)28-15(2)27)18(11-16)23-7-4-6-22(3)13-25(9-10-26)21(23)29-19(24)12-17(22)23/h16-21,26H,1,4-13H2,2-3H3/t16-,17+,18-,19+,20-,21+,22-,23+,24+/m0/s1 |
| InChIKey | LGFAUCMASNAFPV-QFBLJKLRSA-N |
| XLogP | 3.12 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|