C22H31NO2 — CID 163071715
(1R,5R,8R,9R,11R,14R,17S,18R)-7-(2-hydroxyethyl)-5-methyl-12-methylidene-7-azahexacyclo[9.6.2.01,8.05,17.09,14.014,18]nonadecan-16-one (PubChem CID 163071715) has the molecular formula C22H31NO2 and a molecular weight of 341.50 g/mol. Its IUPAC name is (1R,5R,8R,9R,11R,14R,17S,18R)-7-(2-hydroxyethyl)-5-methyl-12-methylidene-7-azahexacyclo[9.6.2.01,8.05,17.09,14.014,18]nonadecan-16-one.
| Compound Name | (1R,5R,8R,9R,11R,14R,17S,18R)-7-(2-hydroxyethyl)-5-methyl-12-methylidene-7-azahexacyclo[9.6.2.01,8.05,17.09,14.014,18]nonadecan-16-one |
|---|---|
| PubChem CID | 163071715 |
| Molecular Formula | C22H31NO2 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.24 |
| IUPAC Name | (1R,5R,8R,9R,11R,14R,17S,18R)-7-(2-hydroxyethyl)-5-methyl-12-methylidene-7-azahexacyclo[9.6.2.01,8.05,17.09,14.014,18]nonadecan-16-one |
| SMILES | C=C1C[C@@]23CC(=O)[C@H]4[C@@]5(C)CCC[C@@]46[C@@H]2C[C@@H]1C[C@H]3[C@H]6N(CCO)C5 |
| InChI | InChI=1S/C22H31NO2/c1-13-10-21-11-16(25)18-20(2)4-3-5-22(18)17(21)9-14(13)8-15(21)19(22)23(12-20)6-7-24/h14-15,17-19,24H,1,3-12H2,2H3/t14-,15-,17+,18-,19+,20-,21-,22+/m0/s1 |
| InChIKey | CFWUHNAFHGLBHO-GXDRNXIWSA-N |
| XLogP | 3.03 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|