C21H27NO3 — CID 163105168
(1R,3S,5R,8S,9S,11S,14R,17R,18R)-3-hydroxy-5,7-dimethyl-12-methylidene-7-azahexacyclo[9.6.2.01,8.05,17.09,14.014,18]nonadecane-10,16-dione (PubChem CID 163105168) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is (1R,3S,5R,8S,9S,11S,14R,17R,18R)-3-hydroxy-5,7-dimethyl-12-methylidene-7-azahexacyclo[9.6.2.01,8.05,17.09,14.014,18]nonadecane-10,16-dione.
| Compound Name | (1R,3S,5R,8S,9S,11S,14R,17R,18R)-3-hydroxy-5,7-dimethyl-12-methylidene-7-azahexacyclo[9.6.2.01,8.05,17.09,14.014,18]nonadecane-10,16-dione |
|---|---|
| PubChem CID | 163105168 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | (1R,3S,5R,8S,9S,11S,14R,17R,18R)-3-hydroxy-5,7-dimethyl-12-methylidene-7-azahexacyclo[9.6.2.01,8.05,17.09,14.014,18]nonadecane-10,16-dione |
| SMILES | C=C1C[C@]23CC(=O)[C@@H]4[C@@]5(C)C[C@H](O)C[C@]46[C@H]([C@H]2C(=O)[C@H]1C[C@H]36)N(C)C5 |
| InChI | InChI=1S/C21H27NO3/c1-10-5-20-8-13(24)17-19(2)6-11(23)7-21(17)14(20)4-12(10)16(25)15(20)18(21)22(3)9-19/h11-12,14-15,17-18,23H,1,4-9H2,2-3H3/t11-,12-,14+,15+,17+,18-,19-,20+,21+/m0/s1 |
| InChIKey | NCYSDVOIDBHHIO-WCGQJWQMSA-N |
| XLogP | 1.82 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|