C23H30NO4+ — CID 146031412
[(1R,3S,8R,9R,11S,14R,16R)-16-hydroxy-5,7-dimethyl-12-methylidene-10-oxo-7-azoniaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecan-3-yl] acetate (PubChem CID 146031412) has the molecular formula C23H30NO4+ and a molecular weight of 384.50 g/mol. Its IUPAC name is [(1R,3S,8R,9R,11S,14R,16R)-16-hydroxy-5,7-dimethyl-12-methylidene-10-oxo-7-azoniaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecan-3-yl] acetate.
| Compound Name | [(1R,3S,8R,9R,11S,14R,16R)-16-hydroxy-5,7-dimethyl-12-methylidene-10-oxo-7-azoniaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecan-3-yl] acetate |
|---|---|
| PubChem CID | 146031412 |
| Molecular Formula | C23H30NO4+ |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | [(1R,3S,8R,9R,11S,14R,16R)-16-hydroxy-5,7-dimethyl-12-methylidene-10-oxo-7-azoniaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecan-3-yl] acetate |
| SMILES | C=C1C[C@@]23C[C@@]4(O)C5C6(C)C[C@H](OC(C)=O)C[C@@]57C2C[C@@H]1C(=O)[C@H]3[C@H]7[N+]4(C)C6 |
| InChI | InChI=1S/C23H30NO4/c1-11-6-21-9-23(27)19-20(3)7-13(28-12(2)25)8-22(19)15(21)5-14(11)17(26)16(21)18(22)24(23,4)10-20/h13-16,18-19,27H,1,5-10H2,2-4H3/q+1/t13-,14-,15?,16-,18+,19?,20?,21+,22-,23+,24?/m0/s1 |
| InChIKey | CJLHIDKWQLJWRW-UMOWFJMHSA-N |
| XLogP | 2.04 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|