C23H31NO5 — CID 45105886
[(1S,3S,5R,11R,16S,19S)-9,10,19-trihydroxy-5-methyl-12-methylidene-7-azaheptacyclo[9.6.2.17,16.01,8.05,17.09,14.014,18]icosan-3-yl] acetate (PubChem CID 45105886) has the molecular formula C23H31NO5 and a molecular weight of 401.50 g/mol. Its IUPAC name is [(1S,3S,5R,11R,16S,19S)-9,10,19-trihydroxy-5-methyl-12-methylidene-7-azaheptacyclo[9.6.2.17,16.01,8.05,17.09,14.014,18]icosan-3-yl] acetate.
| Compound Name | [(1S,3S,5R,11R,16S,19S)-9,10,19-trihydroxy-5-methyl-12-methylidene-7-azaheptacyclo[9.6.2.17,16.01,8.05,17.09,14.014,18]icosan-3-yl] acetate |
|---|---|
| PubChem CID | 45105886 |
| Molecular Formula | C23H31NO5 |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | [(1S,3S,5R,11R,16S,19S)-9,10,19-trihydroxy-5-methyl-12-methylidene-7-azaheptacyclo[9.6.2.17,16.01,8.05,17.09,14.014,18]icosan-3-yl] acetate |
| SMILES | C=C1CC23CC4CN5C[C@]6(C)C[C@H](OC(C)=O)C[C@@]7(C2C(O)[C@@H]1C(O)C3(O)C57)C46 |
| InChI | InChI=1S/C23H31NO5/c1-10-4-21-5-12-8-24-9-20(3)6-13(29-11(2)25)7-22(16(12)20)17(21)15(26)14(10)18(27)23(21,28)19(22)24/h12-19,26-28H,1,4-9H2,2-3H3/t12?,13-,14+,15?,16?,17?,18?,19?,20-,21?,22-,23?/m0/s1 |
| InChIKey | MKBDARIDQJIABU-GFWJTCAISA-N |
| XLogP | 0.70 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|