C29H39NO8 — CID 163104739
(4,10-diacetyloxy-9,19-dihydroxy-5-methyl-12-methylidene-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecan-3-yl) 2-methylbutanoate (PubChem CID 163104739) has the molecular formula C29H39NO8 and a molecular weight of 529.63 g/mol. Its IUPAC name is (4,10-diacetyloxy-9,19-dihydroxy-5-methyl-12-methylidene-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecan-3-yl) 2-methylbutanoate.
| Compound Name | (4,10-diacetyloxy-9,19-dihydroxy-5-methyl-12-methylidene-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecan-3-yl) 2-methylbutanoate |
|---|---|
| PubChem CID | 163104739 |
| Molecular Formula | C29H39NO8 |
| Molecular Weight | 529.63 g/mol |
| Exact Mass | 529.27 |
| IUPAC Name | (4,10-diacetyloxy-9,19-dihydroxy-5-methyl-12-methylidene-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecan-3-yl) 2-methylbutanoate |
| SMILES | C=C1CC23CC4C5C6(C)CN4C4C5(CC(OC(=O)C(C)CC)C6OC(C)=O)C2C(O)C1C(OC(C)=O)C43O |
| InChI | InChI=1S/C29H39NO8/c1-7-12(2)24(34)38-17-10-28-20-16-9-27-8-13(3)18(19(33)21(27)28)23(37-15(5)32)29(27,35)25(28)30(16)11-26(20,6)22(17)36-14(4)31/h12,16-23,25,33,35H,3,7-11H2,1-2,4-6H3 |
| InChIKey | KMAQVOJDJROIFI-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.63 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|