C26H35NO6 — CID 14659439
(10-acetyloxy-9,19-dihydroxy-5-methyl-12-methylidene-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecan-3-yl) 2-methylpropanoate (PubChem CID 14659439) has the molecular formula C26H35NO6 and a molecular weight of 457.57 g/mol. Its IUPAC name is (10-acetyloxy-9,19-dihydroxy-5-methyl-12-methylidene-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecan-3-yl) 2-methylpropanoate.
| Compound Name | (10-acetyloxy-9,19-dihydroxy-5-methyl-12-methylidene-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecan-3-yl) 2-methylpropanoate |
|---|---|
| PubChem CID | 14659439 |
| Molecular Formula | C26H35NO6 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | (10-acetyloxy-9,19-dihydroxy-5-methyl-12-methylidene-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecan-3-yl) 2-methylpropanoate |
| SMILES | C=C1CC23CC4C5C6(C)CC(OC(=O)C(C)C)CC57C2C(O)C1C(OC(C)=O)C3(O)C7N4C6 |
| InChI | InChI=1S/C26H35NO6/c1-11(2)21(30)33-14-7-23(5)10-27-15-9-24-6-12(3)16-17(29)19(24)25(8-14,18(15)23)22(27)26(24,31)20(16)32-13(4)28/h11,14-20,22,29,31H,3,6-10H2,1-2,4-5H3 |
| InChIKey | OMIRUNLROKSDCZ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|