C22H27NO4 — CID 162870739
[(1R,5S,8R,9S,10S,11S,14S,16S,17R,18S)-10-hydroxy-5-methyl-12-methylidene-3-oxo-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecan-18-yl] acetate (PubChem CID 162870739) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is [(1R,5S,8R,9S,10S,11S,14S,16S,17R,18S)-10-hydroxy-5-methyl-12-methylidene-3-oxo-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecan-18-yl] acetate.
| Compound Name | [(1R,5S,8R,9S,10S,11S,14S,16S,17R,18S)-10-hydroxy-5-methyl-12-methylidene-3-oxo-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecan-18-yl] acetate |
|---|---|
| PubChem CID | 162870739 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | [(1R,5S,8R,9S,10S,11S,14S,16S,17R,18S)-10-hydroxy-5-methyl-12-methylidene-3-oxo-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecan-18-yl] acetate |
| SMILES | C=C1C[C@]23C[C@H]4[C@@H]5[C@]6(C)CC(=O)C[C@]57[C@@H]([C@H]2[C@@H](O)[C@H]1C[C@]37OC(C)=O)N4C6 |
| InChI | InChI=1S/C22H27NO4/c1-10-4-20-8-14-17-19(3)5-12(25)6-21(17)18(23(14)9-19)15(20)16(26)13(10)7-22(20,21)27-11(2)24/h13-18,26H,1,4-9H2,2-3H3/t13-,14-,15+,16-,17+,18+,19+,20-,21+,22-/m0/s1 |
| InChIKey | OPSQHQOWJPAFNK-CJRLSBBJSA-N |
| XLogP | 1.69 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|